C22H21ClF3N3O2 — CID 90240676
2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1,2,4-triazol-1-yl)hept-6-en-2-ol (PubChem CID 90240676) has the molecular formula C22H21ClF3N3O2 and a molecular weight of 451.88 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1,2,4-triazol-1-yl)hept-6-en-2-ol.
| Compound Name | 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1,2,4-triazol-1-yl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 90240676 |
| Molecular Formula | C22H21ClF3N3O2 |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(1,2,4-triazol-1-yl)hept-6-en-2-ol |
| SMILES | C=CCCCC(O)(Cn1cncn1)c1ccc(Oc2ccc(Cl)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21ClF3N3O2/c1-2-3-4-11-21(30,13-29-15-27-14-28-29)19-10-9-18(12-20(19)22(24,25)26)31-17-7-5-16(23)6-8-17/h2,5-10,12,14-15,30H,1,3-4,11,13H2 |
| InChIKey | VHOVLFUPGFAQAS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|