C23H24ClF3N3O2+ — CID 123471786
2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(4-methyl-1,2,4-triazol-4-ium-1-yl)hept-6-en-2-ol (PubChem CID 123471786) has the molecular formula C23H24ClF3N3O2+ and a molecular weight of 466.91 g/mol. Its IUPAC name is 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(4-methyl-1,2,4-triazol-4-ium-1-yl)hept-6-en-2-ol.
| Compound Name | 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(4-methyl-1,2,4-triazol-4-ium-1-yl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 123471786 |
| Molecular Formula | C23H24ClF3N3O2+ |
| Molecular Weight | 466.91 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1-(4-methyl-1,2,4-triazol-4-ium-1-yl)hept-6-en-2-ol |
| SMILES | C=CCCCC(O)(Cn1c[n+](C)cn1)c1ccc(Oc2ccc(Cl)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H24ClF3N3O2/c1-3-4-5-12-22(31,14-30-16-29(2)15-28-30)20-11-10-19(13-21(20)23(25,26)27)32-18-8-6-17(24)7-9-18/h3,6-11,13,15-16,31H,1,4-5,12,14H2,2H3/q+1 |
| InChIKey | CZNAFGLOZDIBRB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.91 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|