C13H15ClN6O2 — CID 70527557
2-(4-chlorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol;hydrate (PubChem CID 70527557) has the molecular formula C13H15ClN6O2 and a molecular weight of 322.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol;hydrate.
| Compound Name | 2-(4-chlorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol;hydrate |
|---|---|
| PubChem CID | 70527557 |
| Molecular Formula | C13H15ClN6O2 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol;hydrate |
| SMILES | O.OC(Cn1cncn1)(Cn1cncn1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN6O.H2O/c14-12-3-1-11(2-4-12)13(21,5-19-9-15-7-17-19)6-20-10-16-8-18-20;/h1-4,7-10,21H,5-6H2;1H2 |
| InChIKey | SWXMKIBCOHQBJD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |