C19H20ClN3OSi — CID 19086797
CID 19086797 (PubChem CID 19086797) has the molecular formula C19H20ClN3OSi and a molecular weight of 369.93 g/mol.
| Compound Name | CID 19086797 |
|---|---|
| PubChem CID | 19086797 |
| Molecular Formula | C19H20ClN3OSi |
| Molecular Weight | 369.93 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | — |
| SMILES | Cc1cccc([Si]CC(O)(Cn2cncn2)c2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C19H20ClN3OSi/c1-14-4-3-5-18(15(14)2)25-11-19(24,10-23-13-21-12-22-23)16-6-8-17(20)9-7-16/h3-9,12-13,24H,10-11H2,1-2H3 |
| InChIKey | VZBKHJQCJLSBMT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.93 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|