C14H19Cl2N3OSi — CID 19086787
2-(2,5-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol (PubChem CID 19086787) has the molecular formula C14H19Cl2N3OSi and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol.
| Compound Name | 2-(2,5-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol |
|---|---|
| PubChem CID | 19086787 |
| Molecular Formula | C14H19Cl2N3OSi |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol |
| SMILES | C[Si](C)(C)CC(O)(Cn1cncn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2N3OSi/c1-21(2,3)8-14(20,7-19-10-17-9-18-19)12-6-11(15)4-5-13(12)16/h4-6,9-10,20H,7-8H2,1-3H3 |
| InChIKey | OWJQIICKTLZLPG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|