C15H19Cl2N3OSi — CID 14747893
(E)-2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-4-trimethylsilylbut-3-en-2-ol (PubChem CID 14747893) has the molecular formula C15H19Cl2N3OSi and a molecular weight of 356.33 g/mol. Its IUPAC name is (E)-2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-4-trimethylsilylbut-3-en-2-ol.
| Compound Name | (E)-2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-4-trimethylsilylbut-3-en-2-ol |
|---|---|
| PubChem CID | 14747893 |
| Molecular Formula | C15H19Cl2N3OSi |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (E)-2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)-4-trimethylsilylbut-3-en-2-ol |
| SMILES | C[Si](C)(C)/C=C/C(O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3OSi/c1-22(2,3)7-6-15(21,9-20-11-18-10-19-20)13-5-4-12(16)8-14(13)17/h4-8,10-11,21H,9H2,1-3H3/b7-6+ |
| InChIKey | CNBJWZBAPVAWMU-VOTSOKGWSA-N |
| XLogP | 3.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|