C13H13Cl2N3O2 — CID 139826164
(2R,3S)-3-(2,4-dichlorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanal (PubChem CID 139826164) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is (2R,3S)-3-(2,4-dichlorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanal.
| Compound Name | (2R,3S)-3-(2,4-dichlorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanal |
|---|---|
| PubChem CID | 139826164 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (2R,3S)-3-(2,4-dichlorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butanal |
| SMILES | C[C@@H](C=O)[C@@](O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-9(5-19)13(20,6-18-8-16-7-17-18)11-3-2-10(14)4-12(11)15/h2-5,7-9,20H,6H2,1H3/t9-,13-/m0/s1 |
| InChIKey | GNUXLEPUYARMGY-ZANVPECISA-N |
| XLogP | 2.31 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|