C13H14Cl2IN3O — CID 163481118
3-(2,4-dichlorophenyl)-4-iodo-1-(1,2,4-triazol-1-yl)pentan-3-ol (PubChem CID 163481118) has the molecular formula C13H14Cl2IN3O and a molecular weight of 426.09 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-iodo-1-(1,2,4-triazol-1-yl)pentan-3-ol.
| Compound Name | 3-(2,4-dichlorophenyl)-4-iodo-1-(1,2,4-triazol-1-yl)pentan-3-ol |
|---|---|
| PubChem CID | 163481118 |
| Molecular Formula | C13H14Cl2IN3O |
| Molecular Weight | 426.09 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-iodo-1-(1,2,4-triazol-1-yl)pentan-3-ol |
| SMILES | CC(I)C(O)(CCn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2IN3O/c1-9(16)13(20,4-5-19-8-17-7-18-19)11-3-2-10(14)6-12(11)15/h2-3,6-9,20H,4-5H2,1H3 |
| InChIKey | CEPTXPYKWKPYCK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.09 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|