C14H20FN3OSi — CID 66676543
(2S)-2-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol (PubChem CID 66676543) has the molecular formula C14H20FN3OSi and a molecular weight of 293.42 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol.
| Compound Name | (2S)-2-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol |
|---|---|
| PubChem CID | 66676543 |
| Molecular Formula | C14H20FN3OSi |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2S)-2-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)-3-trimethylsilylpropan-2-ol |
| SMILES | C[Si](C)(C)C[C@@](O)(Cn1cncn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3OSi/c1-20(2,3)9-14(19,8-18-11-16-10-17-18)12-4-6-13(15)7-5-12/h4-7,10-11,19H,8-9H2,1-3H3/t14-/m0/s1 |
| InChIKey | YABFPHSQTSFWQB-AWEZNQCLSA-N |
| XLogP | 2.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|