C15H22FN3OSi — CID 10804679
2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)-1-trimethylsilylbutan-2-ol (PubChem CID 10804679) has the molecular formula C15H22FN3OSi and a molecular weight of 307.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)-1-trimethylsilylbutan-2-ol.
| Compound Name | 2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)-1-trimethylsilylbutan-2-ol |
|---|---|
| PubChem CID | 10804679 |
| Molecular Formula | C15H22FN3OSi |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(1,2,4-triazol-1-yl)-1-trimethylsilylbutan-2-ol |
| SMILES | CC(n1cncn1)C(O)(C[Si](C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FN3OSi/c1-12(19-11-17-10-18-19)15(20,9-21(2,3)4)13-5-7-14(16)8-6-13/h5-8,10-12,20H,9H2,1-4H3 |
| InChIKey | LYPHSVPYZZKSPW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|