C17H14F3N3 — CID 70481120
1-[1-fluoro-1,1-bis(4-fluorophenyl)propan-2-yl]-1,2,4-triazole (PubChem CID 70481120) has the molecular formula C17H14F3N3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-[1-fluoro-1,1-bis(4-fluorophenyl)propan-2-yl]-1,2,4-triazole.
| Compound Name | 1-[1-fluoro-1,1-bis(4-fluorophenyl)propan-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 70481120 |
| Molecular Formula | C17H14F3N3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[1-fluoro-1,1-bis(4-fluorophenyl)propan-2-yl]-1,2,4-triazole |
| SMILES | CC(n1cncn1)C(F)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F3N3/c1-12(23-11-21-10-22-23)17(20,13-2-6-15(18)7-3-13)14-4-8-16(19)9-5-14/h2-12H,1H3 |
| InChIKey | UJWYZXVEXJDERP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |