C14H13Cl2F4N3O — CID 23164279
1-[3-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]-1,2,4-triazole (PubChem CID 23164279) has the molecular formula C14H13Cl2F4N3O and a molecular weight of 386.18 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]-1,2,4-triazole.
| Compound Name | 1-[3-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 23164279 |
| Molecular Formula | C14H13Cl2F4N3O |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]-1,2,4-triazole |
| SMILES | CC(n1cncn1)C(C)(OC(F)(F)C(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2F4N3O/c1-8(23-7-21-6-22-23)13(2,24-14(19,20)12(17)18)10-4-3-9(15)5-11(10)16/h3-8,12H,1-2H3 |
| InChIKey | IWTQXHFIJWZHBO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|