C9H6Cl2FN — CID 124567272
(2S)-2-(2,4-dichlorophenyl)-2-fluoropropanenitrile (PubChem CID 124567272) has the molecular formula C9H6Cl2FN and a molecular weight of 218.06 g/mol. Its IUPAC name is (2S)-2-(2,4-dichlorophenyl)-2-fluoropropanenitrile.
| Compound Name | (2S)-2-(2,4-dichlorophenyl)-2-fluoropropanenitrile |
|---|---|
| PubChem CID | 124567272 |
| Molecular Formula | C9H6Cl2FN |
| Molecular Weight | 218.06 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | (2S)-2-(2,4-dichlorophenyl)-2-fluoropropanenitrile |
| SMILES | C[C@@](F)(C#N)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl2FN/c1-9(12,5-13)7-3-2-6(10)4-8(7)11/h2-4H,1H3/t9-/m1/s1 |
| InChIKey | SCYYOOWSEXGLFZ-SECBINFHSA-N |
| XLogP | 3.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.06 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |