C14H13Cl2N — CID 117060904
2-(2,4-dichlorophenyl)-2-prop-2-enylpent-4-enenitrile (PubChem CID 117060904) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-prop-2-enylpent-4-enenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-2-prop-2-enylpent-4-enenitrile |
|---|---|
| PubChem CID | 117060904 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-prop-2-enylpent-4-enenitrile |
| SMILES | C=CCC(C#N)(CC=C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N/c1-3-7-14(10-17,8-4-2)12-6-5-11(15)9-13(12)16/h3-6,9H,1-2,7-8H2 |
| InChIKey | WZYCHZUGPOMDCU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|