C24H22Cl2N2 — CID 23047293
2-(2,4-dichlorophenyl)-4-phenyl-2-(pyridin-3-ylmethyl)hexanenitrile (PubChem CID 23047293) has the molecular formula C24H22Cl2N2 and a molecular weight of 409.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-4-phenyl-2-(pyridin-3-ylmethyl)hexanenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-4-phenyl-2-(pyridin-3-ylmethyl)hexanenitrile |
|---|---|
| PubChem CID | 23047293 |
| Molecular Formula | C24H22Cl2N2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-4-phenyl-2-(pyridin-3-ylmethyl)hexanenitrile |
| SMILES | CCC(CC(C#N)(Cc1cccnc1)c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C24H22Cl2N2/c1-2-19(20-8-4-3-5-9-20)15-24(17-27,14-18-7-6-12-28-16-18)22-11-10-21(25)13-23(22)26/h3-13,16,19H,2,14-15H2,1H3 |
| InChIKey | FMERQNCENQMKND-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |