C17H18N2 — CID 129384028
(2S,4S)-4-phenyl-2-pyridin-3-ylhexanenitrile (PubChem CID 129384028) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is (2S,4S)-4-phenyl-2-pyridin-3-ylhexanenitrile.
| Compound Name | (2S,4S)-4-phenyl-2-pyridin-3-ylhexanenitrile |
|---|---|
| PubChem CID | 129384028 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (2S,4S)-4-phenyl-2-pyridin-3-ylhexanenitrile |
| SMILES | CC[C@@H](C[C@H](C#N)c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2/c1-2-14(15-7-4-3-5-8-15)11-17(12-18)16-9-6-10-19-13-16/h3-10,13-14,17H,2,11H2,1H3/t14-,17+/m0/s1 |
| InChIKey | ILBZZXIPMCYCOU-WMLDXEAASA-N |
| XLogP | 4.27 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |