C16H16N2 — CID 129364962
(2R,4S)-4-phenyl-2-pyridin-3-ylpentanenitrile (PubChem CID 129364962) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is (2R,4S)-4-phenyl-2-pyridin-3-ylpentanenitrile.
| Compound Name | (2R,4S)-4-phenyl-2-pyridin-3-ylpentanenitrile |
|---|---|
| PubChem CID | 129364962 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2R,4S)-4-phenyl-2-pyridin-3-ylpentanenitrile |
| SMILES | C[C@@H](C[C@@H](C#N)c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2/c1-13(14-6-3-2-4-7-14)10-16(11-17)15-8-5-9-18-12-15/h2-9,12-13,16H,10H2,1H3/t13-,16-/m0/s1 |
| InChIKey | SXLGHLQUTIGHQV-BBRMVZONSA-N |
| XLogP | 3.88 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |