C12H15Cl2N — CID 117049327
2-(2,4-dichlorophenyl)-2-methylpent-4-en-1-amine (PubChem CID 117049327) has the molecular formula C12H15Cl2N and a molecular weight of 244.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-methylpent-4-en-1-amine.
| Compound Name | 2-(2,4-dichlorophenyl)-2-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 117049327 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-methylpent-4-en-1-amine |
| SMILES | C=CCC(C)(CN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N/c1-3-6-12(2,8-15)10-5-4-9(13)7-11(10)14/h3-5,7H,1,6,8,15H2,2H3 |
| InChIKey | TXYKLQJNPIHOTA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|