C9H10Cl2FN — CID 124567259
(2R)-2-(2,4-dichlorophenyl)-2-fluoropropan-1-amine (PubChem CID 124567259) has the molecular formula C9H10Cl2FN and a molecular weight of 222.09 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenyl)-2-fluoropropan-1-amine.
| Compound Name | (2R)-2-(2,4-dichlorophenyl)-2-fluoropropan-1-amine |
|---|---|
| PubChem CID | 124567259 |
| Molecular Formula | C9H10Cl2FN |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenyl)-2-fluoropropan-1-amine |
| SMILES | C[C@](F)(CN)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2FN/c1-9(12,5-13)7-3-2-6(10)4-8(7)11/h2-4H,5,13H2,1H3/t9-/m0/s1 |
| InChIKey | ZKKXDTKKADJPRC-VIFPVBQESA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |