C15H11Cl2N3 — CID 88812905
2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)pent-4-ynenitrile (PubChem CID 88812905) has the molecular formula C15H11Cl2N3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)pent-4-ynenitrile.
| Compound Name | 2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)pent-4-ynenitrile |
|---|---|
| PubChem CID | 88812905 |
| Molecular Formula | C15H11Cl2N3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-2-(1H-imidazol-2-ylmethyl)pent-4-ynenitrile |
| SMILES | C#CCC(C#N)(Cc1ncc[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2N3/c1-2-5-15(10-18,9-14-19-6-7-20-14)12-4-3-11(16)8-13(12)17/h1,3-4,6-8H,5,9H2,(H,19,20) |
| InChIKey | IHCCSFIIBOVEDZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|