About 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol
1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol (PubChem CID 13259983) has the molecular formula C11H9Cl3O
and a molecular weight of 263.55 g/mol. Its IUPAC name is 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol.
Molecular Properties
| Compound Name | 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol |
| PubChem CID | 13259983 |
| Molecular Formula | C11H9Cl3O |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol |
| SMILES | C#CCC(O)(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl3O/c1-2-5-11(15,7-12)9-4-3-8(13)6-10(9)14/h1,3-4,6,15H,5,7H2 |
| InChIKey | OABKZONTISJFMI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol?
The IUPAC name of 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol (CID 13259983) is 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol.
What is the SMILES notation for 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol?
The canonical SMILES for 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol is C#CCC(O)(CCl)c1ccc(Cl)cc1Cl.
What is the InChIKey of 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol?
The InChIKey is OABKZONTISJFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl3O/c1-2-5-11(15,7-12)9-4-3-8(13)6-10(9)14/h1,3-4,6,15H,5,7H2.
What are the key properties of 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol?
1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol has a molecular weight of 263.55 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol is sourced from PubChem (CID 13259983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).