C11H9Cl3O — CID 13259983
1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol (PubChem CID 13259983) has the molecular formula C11H9Cl3O and a molecular weight of 263.55 g/mol. Its IUPAC name is 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol.
| Compound Name | 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol |
|---|---|
| PubChem CID | 13259983 |
| Molecular Formula | C11H9Cl3O |
| Molecular Weight | 263.55 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1-chloro-2-(2,4-dichlorophenyl)pent-4-yn-2-ol |
| SMILES | C#CCC(O)(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl3O/c1-2-5-11(15,7-12)9-4-3-8(13)6-10(9)14/h1,3-4,6,15H,5,7H2 |
| InChIKey | OABKZONTISJFMI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|