C13H10Cl3F3O2 — CID 150715278
1-chloro-2-(2,4-dichlorophenyl)-5-(2,2,2-trifluoroethoxy)pent-3-yn-2-ol (PubChem CID 150715278) has the molecular formula C13H10Cl3F3O2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 1-chloro-2-(2,4-dichlorophenyl)-5-(2,2,2-trifluoroethoxy)pent-3-yn-2-ol.
| Compound Name | 1-chloro-2-(2,4-dichlorophenyl)-5-(2,2,2-trifluoroethoxy)pent-3-yn-2-ol |
|---|---|
| PubChem CID | 150715278 |
| Molecular Formula | C13H10Cl3F3O2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 1-chloro-2-(2,4-dichlorophenyl)-5-(2,2,2-trifluoroethoxy)pent-3-yn-2-ol |
| SMILES | OC(C#CCOCC(F)(F)F)(CCl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3F3O2/c14-7-12(20,4-1-5-21-8-13(17,18)19)10-3-2-9(15)6-11(10)16/h2-3,6,20H,5,7-8H2 |
| InChIKey | JOSYUGLWMDORSH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|