C10H8BrCl2F3O — CID 103211043
1-[1-bromo-2-(2,2,2-trifluoroethoxy)ethyl]-2,4-dichlorobenzene (PubChem CID 103211043) has the molecular formula C10H8BrCl2F3O and a molecular weight of 351.98 g/mol. Its IUPAC name is 1-[1-bromo-2-(2,2,2-trifluoroethoxy)ethyl]-2,4-dichlorobenzene.
| Compound Name | 1-[1-bromo-2-(2,2,2-trifluoroethoxy)ethyl]-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 103211043 |
| Molecular Formula | C10H8BrCl2F3O |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 1-[1-bromo-2-(2,2,2-trifluoroethoxy)ethyl]-2,4-dichlorobenzene |
| SMILES | FC(F)(F)COCC(Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8BrCl2F3O/c11-8(4-17-5-10(14,15)16)7-2-1-6(12)3-9(7)13/h1-3,8H,4-5H2 |
| InChIKey | XIVQIQIBZNPBGU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|