C12H13BrClF3O2 — CID 103211396
2-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-chloro-1-methoxybenzene (PubChem CID 103211396) has the molecular formula C12H13BrClF3O2 and a molecular weight of 361.59 g/mol. Its IUPAC name is 2-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-chloro-1-methoxybenzene.
| Compound Name | 2-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-chloro-1-methoxybenzene |
|---|---|
| PubChem CID | 103211396 |
| Molecular Formula | C12H13BrClF3O2 |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2-[1-bromo-3-(2,2,2-trifluoroethoxy)propyl]-4-chloro-1-methoxybenzene |
| SMILES | COc1ccc(Cl)cc1C(Br)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H13BrClF3O2/c1-18-11-3-2-8(14)6-9(11)10(13)4-5-19-7-12(15,16)17/h2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | DLZXITSWXFHLSQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|