C11H12ClF3O — CID 18741298
4-chloro-2-propan-2-yl-1-(2,2,2-trifluoroethoxy)benzene (PubChem CID 18741298) has the molecular formula C11H12ClF3O and a molecular weight of 252.66 g/mol. Its IUPAC name is 4-chloro-2-propan-2-yl-1-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 4-chloro-2-propan-2-yl-1-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 18741298 |
| Molecular Formula | C11H12ClF3O |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-chloro-2-propan-2-yl-1-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CC(C)c1cc(Cl)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C11H12ClF3O/c1-7(2)9-5-8(12)3-4-10(9)16-6-11(13,14)15/h3-5,7H,6H2,1-2H3 |
| InChIKey | WHVFBVBNGNXXQL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |