C8H6ClF3NO2+ — CID 154675748
[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-oxoazanium (PubChem CID 154675748) has the molecular formula C8H6ClF3NO2+ and a molecular weight of 240.59 g/mol. Its IUPAC name is [5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-oxoazanium.
| Compound Name | [5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-oxoazanium |
|---|---|
| PubChem CID | 154675748 |
| Molecular Formula | C8H6ClF3NO2+ |
| Molecular Weight | 240.59 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | [5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-oxoazanium |
| SMILES | O=[NH+]c1cc(Cl)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C8H5ClF3NO2/c9-5-1-2-7(6(3-5)13-14)15-4-8(10,11)12/h1-3H,4H2/p+1 |
| InChIKey | DIUCBLNLWVIWPF-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 40.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.59 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |