C10H9BrClF3O — CID 135154916
2-(2-bromoethyl)-4-chloro-1-(2,2,2-trifluoroethoxy)benzene (PubChem CID 135154916) has the molecular formula C10H9BrClF3O and a molecular weight of 317.53 g/mol. Its IUPAC name is 2-(2-bromoethyl)-4-chloro-1-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 2-(2-bromoethyl)-4-chloro-1-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 135154916 |
| Molecular Formula | C10H9BrClF3O |
| Molecular Weight | 317.53 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 2-(2-bromoethyl)-4-chloro-1-(2,2,2-trifluoroethoxy)benzene |
| SMILES | FC(F)(F)COc1ccc(Cl)cc1CCBr |
| InChI | InChI=1S/C10H9BrClF3O/c11-4-3-7-5-8(12)1-2-9(7)16-6-10(13,14)15/h1-2,5H,3-4,6H2 |
| InChIKey | NFKMDNDYXSBPFB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|