C11H13ClF3NO2 — CID 65190623
4-amino-3-(5-chloro-2-methoxyphenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 65190623) has the molecular formula C11H13ClF3NO2 and a molecular weight of 283.68 g/mol. Its IUPAC name is 4-amino-3-(5-chloro-2-methoxyphenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 4-amino-3-(5-chloro-2-methoxyphenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 65190623 |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 4-amino-3-(5-chloro-2-methoxyphenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | COc1ccc(Cl)cc1C(CN)C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NO2/c1-18-9-3-2-6(12)4-7(9)8(5-16)10(17)11(13,14)15/h2-4,8,10,17H,5,16H2,1H3 |
| InChIKey | MVYFBJYEYAVIFE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |