C16H20ClNO3 — CID 79086034
3-amino-2-(5-chloro-2-methoxyphenyl)-1-(5-ethylfuran-2-yl)propan-1-ol (PubChem CID 79086034) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 3-amino-2-(5-chloro-2-methoxyphenyl)-1-(5-ethylfuran-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(5-chloro-2-methoxyphenyl)-1-(5-ethylfuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 79086034 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-amino-2-(5-chloro-2-methoxyphenyl)-1-(5-ethylfuran-2-yl)propan-1-ol |
| SMILES | CCc1ccc(C(O)C(CN)c2cc(Cl)ccc2OC)o1 |
| InChI | InChI=1S/C16H20ClNO3/c1-3-11-5-7-15(21-11)16(19)13(9-18)12-8-10(17)4-6-14(12)20-2/h4-8,13,16,19H,3,9,18H2,1-2H3 |
| InChIKey | LMGAUZCRAUQEQR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |