C15H17Cl2NO2 — CID 79083794
3-amino-2-(2,4-dichlorophenyl)-1-(5-ethylfuran-2-yl)propan-1-ol (PubChem CID 79083794) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is 3-amino-2-(2,4-dichlorophenyl)-1-(5-ethylfuran-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(2,4-dichlorophenyl)-1-(5-ethylfuran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 79083794 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-amino-2-(2,4-dichlorophenyl)-1-(5-ethylfuran-2-yl)propan-1-ol |
| SMILES | CCc1ccc(C(O)C(CN)c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C15H17Cl2NO2/c1-2-10-4-6-14(20-10)15(19)12(8-18)11-5-3-9(16)7-13(11)17/h3-7,12,15,19H,2,8,18H2,1H3 |
| InChIKey | DNJLVVRWOOCGHB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |