C13H16ClF3O3 — CID 103210551
2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethoxybenzene (PubChem CID 103210551) has the molecular formula C13H16ClF3O3 and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethoxybenzene.
| Compound Name | 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 103210551 |
| Molecular Formula | C13H16ClF3O3 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(C(Cl)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3O3/c1-18-9-3-4-12(19-2)10(7-9)11(14)5-6-20-8-13(15,16)17/h3-4,7,11H,5-6,8H2,1-2H3 |
| InChIKey | JASKWWIIVQZGOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|