C13H16ClF3O — CID 103210607
2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethylbenzene (PubChem CID 103210607) has the molecular formula C13H16ClF3O and a molecular weight of 280.72 g/mol. Its IUPAC name is 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethylbenzene.
| Compound Name | 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 103210607 |
| Molecular Formula | C13H16ClF3O |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(C(Cl)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3O/c1-9-3-4-10(2)11(7-9)12(14)5-6-18-8-13(15,16)17/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | UUVONFOCHWFRQX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|