C13H15ClF4O — CID 103211169
5-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-2-fluoro-1,3-dimethylbenzene (PubChem CID 103211169) has the molecular formula C13H15ClF4O and a molecular weight of 298.71 g/mol. Its IUPAC name is 5-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-2-fluoro-1,3-dimethylbenzene.
| Compound Name | 5-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-2-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 103211169 |
| Molecular Formula | C13H15ClF4O |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-2-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(C(Cl)CCOCC(F)(F)F)cc(C)c1F |
| InChI | InChI=1S/C13H15ClF4O/c1-8-5-10(6-9(2)12(8)15)11(14)3-4-19-7-13(16,17)18/h5-6,11H,3-4,7H2,1-2H3 |
| InChIKey | JZFCOMNZVFPXKX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|