C12H12ClF5O2 — CID 103210489
2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,3-difluoro-5-methoxybenzene (PubChem CID 103210489) has the molecular formula C12H12ClF5O2 and a molecular weight of 318.67 g/mol. Its IUPAC name is 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,3-difluoro-5-methoxybenzene.
| Compound Name | 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,3-difluoro-5-methoxybenzene |
|---|---|
| PubChem CID | 103210489 |
| Molecular Formula | C12H12ClF5O2 |
| Molecular Weight | 318.67 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[1-chloro-3-(2,2,2-trifluoroethoxy)propyl]-1,3-difluoro-5-methoxybenzene |
| SMILES | COc1cc(F)c(C(Cl)CCOCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H12ClF5O2/c1-19-7-4-9(14)11(10(15)5-7)8(13)2-3-20-6-12(16,17)18/h4-5,8H,2-3,6H2,1H3 |
| InChIKey | TXQAIWASGDUKHH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|