C12H15ClF2O — CID 63427268
2-(1-chloro-2-methylbutyl)-1,3-difluoro-5-methoxybenzene (PubChem CID 63427268) has the molecular formula C12H15ClF2O and a molecular weight of 248.70 g/mol. Its IUPAC name is 2-(1-chloro-2-methylbutyl)-1,3-difluoro-5-methoxybenzene.
| Compound Name | 2-(1-chloro-2-methylbutyl)-1,3-difluoro-5-methoxybenzene |
|---|---|
| PubChem CID | 63427268 |
| Molecular Formula | C12H15ClF2O |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-(1-chloro-2-methylbutyl)-1,3-difluoro-5-methoxybenzene |
| SMILES | CCC(C)C(Cl)c1c(F)cc(OC)cc1F |
| InChI | InChI=1S/C12H15ClF2O/c1-4-7(2)12(13)11-9(14)5-8(16-3)6-10(11)15/h5-7,12H,4H2,1-3H3 |
| InChIKey | GZRWKGPLQLQLFX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|