C15H11Cl3F2O — CID 63427176
2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1,3-difluoro-5-methoxybenzene (PubChem CID 63427176) has the molecular formula C15H11Cl3F2O and a molecular weight of 351.61 g/mol. Its IUPAC name is 2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1,3-difluoro-5-methoxybenzene.
| Compound Name | 2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1,3-difluoro-5-methoxybenzene |
|---|---|
| PubChem CID | 63427176 |
| Molecular Formula | C15H11Cl3F2O |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-1,3-difluoro-5-methoxybenzene |
| SMILES | COc1cc(F)c(C(Cl)Cc2ccc(Cl)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C15H11Cl3F2O/c1-21-9-6-13(19)15(14(20)7-9)12(18)5-8-2-3-10(16)11(17)4-8/h2-4,6-7,12H,5H2,1H3 |
| InChIKey | CNLUONIJSPWDBC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|