C14H9Cl3F2 — CID 63433697
1,2-dichloro-4-[2-chloro-2-(2,4-difluorophenyl)ethyl]benzene (PubChem CID 63433697) has the molecular formula C14H9Cl3F2 and a molecular weight of 321.58 g/mol. Its IUPAC name is 1,2-dichloro-4-[2-chloro-2-(2,4-difluorophenyl)ethyl]benzene.
| Compound Name | 1,2-dichloro-4-[2-chloro-2-(2,4-difluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 63433697 |
| Molecular Formula | C14H9Cl3F2 |
| Molecular Weight | 321.58 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 1,2-dichloro-4-[2-chloro-2-(2,4-difluorophenyl)ethyl]benzene |
| SMILES | Fc1ccc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C14H9Cl3F2/c15-11-4-1-8(6-13(11)17)5-12(16)10-3-2-9(18)7-14(10)19/h1-4,6-7,12H,5H2 |
| InChIKey | UWEWSJCPAVDNBW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|