C12H7Br2Cl3S — CID 55197767
2,5-dibromo-3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]thiophene (PubChem CID 55197767) has the molecular formula C12H7Br2Cl3S and a molecular weight of 449.42 g/mol. Its IUPAC name is 2,5-dibromo-3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]thiophene.
| Compound Name | 2,5-dibromo-3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 55197767 |
| Molecular Formula | C12H7Br2Cl3S |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 445.77 |
| IUPAC Name | 2,5-dibromo-3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]thiophene |
| SMILES | Clc1ccc(CC(Cl)c2cc(Br)sc2Br)cc1Cl |
| InChI | InChI=1S/C12H7Br2Cl3S/c13-11-5-7(12(14)18-11)9(16)3-6-1-2-8(15)10(17)4-6/h1-2,4-5,9H,3H2 |
| InChIKey | ZEBRBLLUNIFIPY-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|