C12H9Cl3N2 — CID 114552967
2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]pyrimidine (PubChem CID 114552967) has the molecular formula C12H9Cl3N2 and a molecular weight of 287.58 g/mol. Its IUPAC name is 2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]pyrimidine.
| Compound Name | 2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]pyrimidine |
|---|---|
| PubChem CID | 114552967 |
| Molecular Formula | C12H9Cl3N2 |
| Molecular Weight | 287.58 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 2-[1-chloro-2-(3,4-dichlorophenyl)ethyl]pyrimidine |
| SMILES | Clc1ccc(CC(Cl)c2ncccn2)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N2/c13-9-3-2-8(6-10(9)14)7-11(15)12-16-4-1-5-17-12/h1-6,11H,7H2 |
| InChIKey | YFPIHRPEXMBUHW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|