C14H13Cl3O — CID 63530762
3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-2,5-dimethylfuran (PubChem CID 63530762) has the molecular formula C14H13Cl3O and a molecular weight of 303.62 g/mol. Its IUPAC name is 3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-2,5-dimethylfuran.
| Compound Name | 3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 63530762 |
| Molecular Formula | C14H13Cl3O |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 3-[1-chloro-2-(3,4-dichlorophenyl)ethyl]-2,5-dimethylfuran |
| SMILES | Cc1cc(C(Cl)Cc2ccc(Cl)c(Cl)c2)c(C)o1 |
| InChI | InChI=1S/C14H13Cl3O/c1-8-5-11(9(2)18-8)13(16)6-10-3-4-12(15)14(17)7-10/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | DBQDHMAOPJJORV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|