C16H20O2 — CID 114980726
1-(2,5-dimethylfuran-3-yl)-2-(4-ethylphenyl)ethanol (PubChem CID 114980726) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)-2-(4-ethylphenyl)ethanol.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)-2-(4-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 114980726 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)-2-(4-ethylphenyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cc(C)oc2C)cc1 |
| InChI | InChI=1S/C16H20O2/c1-4-13-5-7-14(8-6-13)10-16(17)15-9-11(2)18-12(15)3/h5-9,16-17H,4,10H2,1-3H3 |
| InChIKey | REJNUWURFKASMV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |