C11H18O2 — CID 115783226
1-(2,5-dimethylfuran-3-yl)pentan-1-ol (PubChem CID 115783226) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)pentan-1-ol.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)pentan-1-ol |
|---|---|
| PubChem CID | 115783226 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)pentan-1-ol |
| SMILES | CCCCC(O)c1cc(C)oc1C |
| InChI | InChI=1S/C11H18O2/c1-4-5-6-11(12)10-7-8(2)13-9(10)3/h7,11-12H,4-6H2,1-3H3 |
| InChIKey | FJKNMRPVWFTXHX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |