C11H18O3 — CID 115818822
1-(2,5-dimethylfuran-3-yl)-2-propoxyethanol (PubChem CID 115818822) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)-2-propoxyethanol.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)-2-propoxyethanol |
|---|---|
| PubChem CID | 115818822 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)-2-propoxyethanol |
| SMILES | CCCOCC(O)c1cc(C)oc1C |
| InChI | InChI=1S/C11H18O3/c1-4-5-13-7-11(12)10-6-8(2)14-9(10)3/h6,11-12H,4-5,7H2,1-3H3 |
| InChIKey | ZWJKKLCNOZLQEG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|