C15H17BrO — CID 55222953
3-[1-bromo-2-(4-methylphenyl)ethyl]-2,5-dimethylfuran (PubChem CID 55222953) has the molecular formula C15H17BrO and a molecular weight of 293.20 g/mol. Its IUPAC name is 3-[1-bromo-2-(4-methylphenyl)ethyl]-2,5-dimethylfuran.
| Compound Name | 3-[1-bromo-2-(4-methylphenyl)ethyl]-2,5-dimethylfuran |
|---|---|
| PubChem CID | 55222953 |
| Molecular Formula | C15H17BrO |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-[1-bromo-2-(4-methylphenyl)ethyl]-2,5-dimethylfuran |
| SMILES | Cc1ccc(CC(Br)c2cc(C)oc2C)cc1 |
| InChI | InChI=1S/C15H17BrO/c1-10-4-6-13(7-5-10)9-15(16)14-8-11(2)17-12(14)3/h4-8,15H,9H2,1-3H3 |
| InChIKey | BQBRCAPFKPSXLZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|