C15H17F3N2O — CID 105299682
[1-(2,5-dimethylfuran-3-yl)-2-[4-(trifluoromethyl)phenyl]ethyl]hydrazine (PubChem CID 105299682) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is [1-(2,5-dimethylfuran-3-yl)-2-[4-(trifluoromethyl)phenyl]ethyl]hydrazine.
| Compound Name | [1-(2,5-dimethylfuran-3-yl)-2-[4-(trifluoromethyl)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 105299682 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [1-(2,5-dimethylfuran-3-yl)-2-[4-(trifluoromethyl)phenyl]ethyl]hydrazine |
| SMILES | Cc1cc(C(Cc2ccc(C(F)(F)F)cc2)NN)c(C)o1 |
| InChI | InChI=1S/C15H17F3N2O/c1-9-7-13(10(2)21-9)14(20-19)8-11-3-5-12(6-4-11)15(16,17)18/h3-7,14,20H,8,19H2,1-2H3 |
| InChIKey | SALJUWSSPHBVMN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|