C15H17F3N2O — CID 102759916
[(2,5-dimethylfuran-3-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 102759916) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is [(2,5-dimethylfuran-3-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [(2,5-dimethylfuran-3-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 102759916 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [(2,5-dimethylfuran-3-yl)-[2-methyl-4-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2ccc(C(F)(F)F)cc2C)c(C)o1 |
| InChI | InChI=1S/C15H17F3N2O/c1-8-6-11(15(16,17)18)4-5-12(8)14(20-19)13-7-9(2)21-10(13)3/h4-7,14,20H,19H2,1-3H3 |
| InChIKey | JFZSJYLBPBMMJF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|