C14H16F2N2O — CID 105330361
[2-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine (PubChem CID 105330361) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105330361 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [2-(3,4-difluorophenyl)-1-(2,5-dimethylfuran-3-yl)ethyl]hydrazine |
| SMILES | Cc1cc(C(Cc2ccc(F)c(F)c2)NN)c(C)o1 |
| InChI | InChI=1S/C14H16F2N2O/c1-8-5-11(9(2)19-8)14(18-17)7-10-3-4-12(15)13(16)6-10/h3-6,14,18H,7,17H2,1-2H3 |
| InChIKey | FOXDEPHCOAYPGW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|