C14H14F3N3 — CID 105263263
2-[2-(3,4-difluorophenyl)-1-hydrazinylethyl]-4-fluoroaniline (PubChem CID 105263263) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-1-hydrazinylethyl]-4-fluoroaniline.
| Compound Name | 2-[2-(3,4-difluorophenyl)-1-hydrazinylethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 105263263 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-1-hydrazinylethyl]-4-fluoroaniline |
| SMILES | NNC(Cc1ccc(F)c(F)c1)c1cc(F)ccc1N |
| InChI | InChI=1S/C14H14F3N3/c15-9-2-4-13(18)10(7-9)14(20-19)6-8-1-3-11(16)12(17)5-8/h1-5,7,14,20H,6,18-19H2 |
| InChIKey | ADOQLMYRGHWRNA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|