C14H12F3NO — CID 82920437
1-(2-amino-5-fluorophenyl)-2-(3,4-difluorophenyl)ethanol (PubChem CID 82920437) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is 1-(2-amino-5-fluorophenyl)-2-(3,4-difluorophenyl)ethanol.
| Compound Name | 1-(2-amino-5-fluorophenyl)-2-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 82920437 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(2-amino-5-fluorophenyl)-2-(3,4-difluorophenyl)ethanol |
| SMILES | Nc1ccc(F)cc1C(O)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H12F3NO/c15-9-2-4-13(18)10(7-9)14(19)6-8-1-3-11(16)12(17)5-8/h1-5,7,14,19H,6,18H2 |
| InChIKey | KHARRIOAGVEMGE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|