C14H12Cl2FNO — CID 82685676
1-(2-amino-5-fluorophenyl)-2-(2,5-dichlorophenyl)ethanol (PubChem CID 82685676) has the molecular formula C14H12Cl2FNO and a molecular weight of 300.16 g/mol. Its IUPAC name is 1-(2-amino-5-fluorophenyl)-2-(2,5-dichlorophenyl)ethanol.
| Compound Name | 1-(2-amino-5-fluorophenyl)-2-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 82685676 |
| Molecular Formula | C14H12Cl2FNO |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(2-amino-5-fluorophenyl)-2-(2,5-dichlorophenyl)ethanol |
| SMILES | Nc1ccc(F)cc1C(O)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H12Cl2FNO/c15-9-1-3-12(16)8(5-9)6-14(19)11-7-10(17)2-4-13(11)18/h1-5,7,14,19H,6,18H2 |
| InChIKey | PBWZRPMACUCKIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|